compound 1 [PMID: 28379944]
| SMILES | CCc1nc2c(cc(cc2)N(Cc2ccccc2)C(=O)c2cccs2)c(=O)n1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1 |
| InChIKey | KDPHUUTUDFDLBT-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 8 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 9 |
| Molecular weight (Da) | 623.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| AT1 | AGTR1 | Human | Angiotensin | A | pKi | 6.74 | 6.74 | 6.74 | Guide to Pharmacology |
| AT2 | AGTR2 | Human | Angiotensin | A | pKi | 9.47 | 9.47 | 9.47 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| AT2 | AGTR2 | Rat | Angiotensin | A | pIC50 | 10.22 | 10.22 | 10.22 | ChEMBL |
| AT1 | AGTR1 | Rabbit | Angiotensin | A | pIC50 | 6.7 | 6.7 | 6.7 | ChEMBL |