compound 46 [PMID: 25268943]
| SMILES | NC(=N)NCCNC(=O)C1(CCN(CC1)Cc1ccccc1)Nc1ccccc1 |
| InChIKey | SCPYAGLHLAAYFP-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 5 |
| Rotatable bonds | 8 |
| Molecular weight (Da) | 394.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| NPFF1 | NPFF1 | Human | Neuropeptide FF/neuropeptide AF | A | pKi | 7.09 | 7.09 | 7.09 | Guide to Pharmacology |
| NPFF2 | NPFF2 | Human | Neuropeptide FF/neuropeptide AF | A | pKi | 5.85 | 5.85 | 5.85 | Guide to Pharmacology |
| NPFF1 | NPFF1 | Human | Neuropeptide FF/neuropeptide AF | A | pKi | 7.09 | 7.09 | 7.09 | ChEMBL |
| NPFF2 | NPFF2 | Human | Neuropeptide FF/neuropeptide AF | A | pKi | 5.85 | 5.85 | 5.85 | ChEMBL |
| μ | OPRM | Human | Opioid | A | pKi | 6.7 | 6.7 | 6.7 | ChEMBL |
| δ | OPRD | Human | Opioid | A | pKi | 5.6 | 5.6 | 5.6 | ChEMBL |
| κ | OPRK | Human | Opioid | A | pKi | 6.65 | 6.65 | 6.65 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| NPFF1 | NPFF1 | Human | Neuropeptide FF/neuropeptide AF | A | pEC50 | 5.45 | 5.45 | 5.45 | ChEMBL |