compound 5g [PMID: 21571530]
| SMILES | O=C(NCc1onc(c1)c1ccc(c(c1)C(F)(F)F)F)CCCc1ccc2c(n1)nccc2 |
| InChIKey | SWKGPCNQBPGWNX-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 5 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 7 |
| Molecular weight (Da) | 458.1 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| succinate | SUCR1 | Human | Succinate | A | pIC50 | 7.46 | 7.46 | 7.46 | Guide to Pharmacology |
| succinate | SUCR1 | Rat | Succinate | A | pIC50 | 6.87 | 6.87 | 6.87 | Guide to Pharmacology |
| succinate | SUCR1 | Human | Succinate | A | pIC50 | 7.46 | 7.46 | 7.46 | ChEMBL |
| succinate | SUCR1 | Rat | Succinate | A | pIC50 | 6.87 | 6.87 | 6.87 | ChEMBL |