DCG-IV
| SMILES | N[C@@H](C1[C@H]([C@@H]1C(=O)O)C(=O)O)C(=O)O |
| InChIKey | MATPZHBYOVDBLI-JJYYJPOSSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 4 |
| Rotatable bonds | 4 |
| Molecular weight (Da) | 203.0 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 6.5 | 6.5 | 6.5 | Guide to Pharmacology |
| mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pKi | 7.2 | 7.2 | 7.2 | Guide to Pharmacology |
| mGlu7 | GRM7 | Human | Metabotropic glutamate | C | pKi | 4.7 | 4.7 | 4.7 | Guide to Pharmacology |
| mGlu3 | GRM3 | Rat | Metabotropic glutamate | C | pKi | 6.8 | 6.8 | 6.8 | Guide to Pharmacology |
| mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pKi | 7.0 | 7.0 | 7.0 | Guide to Pharmacology |
| mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pKi | 4.1 | 4.1 | 4.1 | Guide to Pharmacology |
| mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pKi | 4.11 | 4.11 | 4.11 | ChEMBL |
| mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 6.96 | 6.96 | 6.96 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu8 | GRM8 | Human | Metabotropic glutamate | C | pIC50 | 5.5 | 5.5 | 5.5 | Guide to Pharmacology |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pIC50 | 4.7 | 4.7 | 4.7 | Guide to Pharmacology |
| mGlu6 | GRM6 | Rat | Metabotropic glutamate | C | pEC50 | 5.6 | 5.6 | 5.6 | Guide to Pharmacology |
| mGlu6 | GRM6 | Rat | Metabotropic glutamate | C | pEC50 | 4.4 | 4.4 | 4.4 | ChEMBL |
| mGlu3 | GRM3 | Rat | Metabotropic glutamate | C | pEC50 | 6.52 | 6.77 | 7.1 | ChEMBL |
| mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pEC50 | 6.46 | 6.71 | 7.35 | ChEMBL |
| mGlu7 | GRM7 | Rat | Metabotropic glutamate | C | pEC50 | 4.4 | 4.4 | 4.4 | ChEMBL |
| mGlu8 | GRM8 | Rat | Metabotropic glutamate | C | pEC50 | 4.5 | 4.5 | 4.5 | ChEMBL |
| mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pEC50 | 4.64 | 4.64 | 4.64 | ChEMBL |