denufosol
SMILES | Nc1ccn(c(=O)n1)[C@@H]1O[C@@H]([C@H](C1)O)COP(=O)(OP(=O)(OP(=O)(OP(=O)(OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1ccc(=O)[nH]c1=O)O)O)O)O |
InChIKey | FPNPSEMJLALQSA-MIYUEGBISA-N |
Chemical properties
Hydrogen bond acceptors | 21 |
Hydrogen bond donors | 9 |
Rotatable bonds | 14 |
Molecular weight (Da) | 773.0 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
P2Y2 | P2RY2 | Human | P2Y | A | pEC50 | 6.7 | 6.7 | 6.7 | Guide to Pharmacology |
P2Y4 | P2RY4 | Human | P2Y | A | pEC50 | 6.1 | 6.47 | 6.85 | ChEMBL |
P2Y6 | P2RY6 | Human | P2Y | A | pEC50 | 6.02 | 6.02 | 6.02 | ChEMBL |
P2Y2 | P2RY2 | Human | P2Y | A | pEC50 | 6.57 | 6.7 | 6.85 | ChEMBL |
P2Y4 | P2RY4 | Human | P2Y | A | pEC50 | 6.1 | 6.1 | 6.1 | Guide to Pharmacology |