eGlu
| SMILES | CC[C@@](C(=O)O)(CCC(=O)O)N |
| InChIKey | QFYBYZLHPIALCZ-ZETCQYMHSA-N |
Chemical properties
| Hydrogen bond acceptors | 3 |
| Hydrogen bond donors | 3 |
| Rotatable bonds | 5 |
| Molecular weight (Da) | 175.1 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu3 | GRM3 | Rat | Metabotropic glutamate | C | pKi | 5.4 | 5.4 | 5.4 | Guide to Pharmacology |
| mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pKi | 4.4 | 4.5 | 4.6 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |