CHEMBL4126100
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)CCSCc2ccccc2CSC[C@@H](C(=O)N2CCC[C@H]2C(=O)N[C@@H](CCCNC(=N)N)C(=O)NCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O |
| InChIKey | XYHRDUDUOHRZSR-SXXMFYQFSA-N |
Chemical properties
| Hydrogen bond acceptors | 15 |
| Hydrogen bond donors | 14 |
| Rotatable bonds | 19 |
| Molecular weight (Da) | 1138.5 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 6.78 | 6.78 | 6.78 | ChEMBL |
| V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 7.52 | 7.52 | 7.52 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| V1B | V1BR | Human | Vasopressin and oxytocin | A | pEC50 | 5.03 | 5.03 | 5.03 | ChEMBL |
| V2 | V2R | Human | Vasopressin and oxytocin | A | pEC50 | 4.72 | 4.72 | 4.72 | ChEMBL |
| OT | OXYR | Human | Vasopressin and oxytocin | A | pIC50 | 5.76 | 5.76 | 5.76 | ChEMBL |
| V1A | V1AR | Human | Vasopressin and oxytocin | A | pIC50 | 7.85 | 7.85 | 7.85 | ChEMBL |