GSK1614343
| SMILES | O=C([C@@H](c1cccnc1)N1CCN2[C@@H](C1)CCC2)NNc1cc(cc(c1)C(F)(F)F)C(F)(F)F |
| InChIKey | QNOSCJDGJKVFJR-RTBURBONSA-N |
Chemical properties
| Hydrogen bond acceptors | 5 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 5 |
| Molecular weight (Da) | 487.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| ghrelin | GHSR | Human | Ghrelin | A | pIC50 | 8.4 | 8.4 | 8.4 | Guide to Pharmacology |
| ghrelin | GHSR | Rat | Ghrelin | A | pKB | 8.0 | 8.0 | 8.0 | Guide to Pharmacology |
| ghrelin | GHSR | Human | Ghrelin | A | pIC50 | 8.4 | 8.4 | 8.4 | ChEMBL |