ICI 118551
| SMILES | Cc1c2CCCc2c(cc1)OC[C@H]([C@H](C)NC(C)C)O |
| InChIKey | VFIDUCMKNJIJTO-XJKSGUPXSA-N |
Chemical properties
| Hydrogen bond acceptors | 3 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 6 |
| Molecular weight (Da) | 277.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| β2 | ADRB2 | Human | Adrenoceptors | A | pKi | 9.2 | 9.35 | 9.5 | Guide to Pharmacology |
| β3 | ADRB3 | Human | Adrenoceptors | A | pKi | 5.8 | 6.2 | 6.6 | Guide to Pharmacology |
| β1 | ADRB1 | Human | Adrenoceptors | A | pKd | 6.74 | 6.74 | 6.74 | ChEMBL |
| β2 | ADRB2 | Human | Adrenoceptors | A | pKd | 6.2 | 8.44 | 9.61 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| β2 | ADRB2 | Human | Adrenoceptors | A | pIC50 | 9.13 | 9.13 | 9.13 | ChEMBL |
| TSH | TSHR | Human | Glycoprotein hormone | A | Potency | 4.4 | 4.4 | 4.4 | ChEMBL |