CHEMBL572709
| SMILES | COc1ccc(S(=O)(=O)N2c3ccccc3CCC2CCS(=O)(=O)N2CCC(NCC3CCCCC3)CC2)c(OC)c1 |
| InChIKey | XQDRFXUPGZPPOW-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 7 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 11 |
| Molecular weight (Da) | 619.3 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| V1B | V1BR | Rat | Vasopressin and oxytocin | A | pKi | 6.06 | 7.18 | 7.8 | ChEMBL |
| V1A | V1AR | Rat | Vasopressin and oxytocin | A | pKi | 5.43 | 5.57 | 5.72 | ChEMBL |
| V1B | V1BR | Human | Vasopressin and oxytocin | A | pKi | 6.68 | 7.14 | 7.36 | ChEMBL |
| OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 5.26 | 5.88 | 6.5 | ChEMBL |
| V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 5.25 | 6.11 | 6.73 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |