INCB-38579
| SMILES | CN1CCN(CC1)C1=CC(=NC(N1)N)c1ccc2c(c1)CN(CC2)C(=O)CCC1CCCC1 |
| InChIKey | JZAGLPUCLXBELH-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 6 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 5 |
| Molecular weight (Da) | 450.3 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| H1 | HRH1 | Human | Histamine | A | pKi | 5.0 | 5.0 | 5.0 | Guide to Pharmacology |
| H2 | HRH2 | Human | Histamine | A | pKi | 5.3 | 5.3 | 5.3 | Guide to Pharmacology |
| H3 | HRH3 | Human | Histamine | A | pKi | 6.39 | 6.39 | 6.39 | Guide to Pharmacology |
| H4 | HRH4 | Human | Histamine | A | pKi | 8.3 | 8.3 | 8.3 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |