ITP
| SMILES | O[C@@H]1[C@@H](COP(=O)(OP(=O)(OP(=O)(O)O)O)O)O[C@H]([C@@H]1O)n1cnc2c1[nH]cnc2=O |
| InChIKey | HAEJPQIATWHALX-KQYNXXCUSA-N |
Chemical properties
| Hydrogen bond acceptors | 13 |
| Hydrogen bond donors | 7 |
| Rotatable bonds | 8 |
| Molecular weight (Da) | 508.0 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| P2Y4 | P2RY4 | Human | P2Y | A | pEC50 | 5.1 | 5.1 | 5.1 | Guide to Pharmacology |
| P2Y4 | P2RY4 | Rat | P2Y | A | pEC50 | 5.7 | 5.75 | 5.8 | Guide to Pharmacology |