kynurenic acid
| SMILES | OC(=O)c1cc(=O)c2c([nH]1)cccc2 |
| InChIKey | HCZHHEIFKROPDY-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 2 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 1 |
| Molecular weight (Da) | 189.0 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Endogenous |
| Approved drug | Yes |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| GPR35 | GPR35 | Human | A orphans | A | pEC50 | 3.9 | 4.16 | 4.41 | Guide to Pharmacology |
| GPR35 | GPR35 | Mouse | A orphans | A | pEC50 | 4.96 | 4.96 | 4.96 | Guide to Pharmacology |
| GPR35 | Q33BM1 | Rat | A orphans | A | pEC50 | 5.15 | 5.15 | 5.15 | Guide to Pharmacology |
| GPR35 | Q33BM1 | Rat | A orphans | A | pEC50 | 4.18 | 4.18 | 4.18 | ChEMBL |
| GPR35 | GPR35 | Human | A orphans | A | pEC50 | 3.66 | 3.93 | 4.41 | ChEMBL |
| GPR35 | GPR35 | Human | A orphans | A | pIC50 | 4.41 | 4.41 | 4.41 | ChEMBL |
| M1 | ACM1 | Rat | Acetylcholine (muscarinic) | A | Potency | 7.75 | 7.75 | 7.75 | ChEMBL |