LSN2814617
| SMILES | Fc1ccc(cc1)c1noc(n1)[C@H]1CCn2c(C1)nnc2C(C)(C)C |
| InChIKey | NPRJTKMKUYJGAL-LBPRGKRZSA-N |
Chemical properties
| Hydrogen bond acceptors | 6 |
| Hydrogen bond donors | 0 |
| Rotatable bonds | 2 |
| Molecular weight (Da) | 341.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 5.87 | 5.87 | 5.87 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pEC50 | 7.28 | 7.28 | 7.28 | Guide to Pharmacology |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pEC50 | 7.03 | 7.03 | 7.03 | Guide to Pharmacology |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pEC50 | 7.38 | 7.38 | 7.38 | ChEMBL |
| mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pEC50 | 7.28 | 7.28 | 7.28 | ChEMBL |