MRS2567
| SMILES | S=C=Nc1ccc(cc1)CCc1ccc(cc1)N=C=S |
| InChIKey | KGPFLJVFCCOOEO-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 0 |
| Rotatable bonds | 5 |
| Molecular weight (Da) | 296.0 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| P2Y6 | P2RY6 | Human | P2Y | A | pIC50 | 6.9 | 6.9 | 6.9 | Guide to Pharmacology |
| P2Y6 | P2RY6 | Rat | P2Y | A | pIC50 | 7.0 | 7.0 | 7.0 | Guide to Pharmacology |