NF-56-EJ40
| SMILES | CN1CCN(CC1)Cc1ccc(cc1)c1cccc(c1)C(=O)Nc1ccccc1CC(=O)O |
| InChIKey | UTWXDNZWMQAUKL-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 7 |
| Molecular weight (Da) | 443.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
| Structure pdb | 6RNK |
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| succinate | SUCR1 | Human | Succinate | A | pKi | 7.76 | 7.76 | 7.76 | Guide to Pharmacology |
| succinate | SUCR1 | Human | Succinate | A | pKd | 7.48 | 7.48 | 7.48 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| succinate | SUCR1 | Human | Succinate | A | pIC50 | 7.6 | 7.6 | 7.6 | ChEMBL |