ONO-4057
| SMILES | COc1ccc(cc1)/C=C/CCCCOc1cccc(c1CCC(=O)O)OCCCCC(=O)O |
| InChIKey | JOPSSWGWLCLPPF-RUDMXATFSA-N |
Chemical properties
| Hydrogen bond acceptors | 5 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 17 |
| Molecular weight (Da) | 470.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| BLT1 | LT4R1 | Human | Leukotriene | A | pKi | 8.43 | 8.43 | 8.43 | Guide to Pharmacology |
| BLT1 | LT4R1 | Human | Leukotriene | A | pKi | 8.4 | 8.41 | 8.43 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| BLT1 | LT4R1 | Human | Leukotriene | A | pIC50 | 5.52 | 5.83 | 6.15 | Guide to Pharmacology |