PD-156707
| SMILES | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] |
| InChIKey | ZLHQEGFYBMZQGM-RKVLWQGQSA-M |
Chemical properties
| Hydrogen bond acceptors | 9 |
| Hydrogen bond donors | 0 |
| Rotatable bonds | 10 |
| Molecular weight (Da) | 528.1 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| ETA | EDNRA | Human | Endothelin | A | pKd | 9.0 | 9.4 | 9.8 | Guide to Pharmacology |
| ETA | EDNRA | Human | Endothelin | A | pKi | 9.77 | 9.77 | 9.77 | ChEMBL |
| ETA | EDNRA | Human | Endothelin | A | pKd | 7.6 | 7.6 | 7.6 | ChEMBL |
| ETB | EDNRB | Human | Endothelin | A | pKi | 6.86 | 6.86 | 6.86 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| ETA | EDNRA | Human | Endothelin | A | pA2 | 8.1 | 8.65 | 9.2 | Guide to Pharmacology |
| ETA | EDNRA | Rat | Endothelin | A | pIC50 | 8.89 | 8.89 | 8.89 | ChEMBL |
| ETA | EDNRA | Human | Endothelin | A | pIC50 | 9.51 | 9.51 | 9.51 | ChEMBL |
| ETB | EDNRB | Human | Endothelin | A | pIC50 | 6.38 | 6.38 | 6.38 | ChEMBL |
| ETB | EDNRB | Pig | Endothelin | A | pIC50 | 6.47 | 6.47 | 6.47 | ChEMBL |