PF-05190457
| SMILES | Cc1ncnc(c1)c1ccc2c(c1)CC[C@H]2N1CC2(C1)CCN(CC2)C(=O)Cc1nc2n(c1)cc(s2)C |
| InChIKey | ZIUDADZJCKGWKR-AREMUKBSSA-N |
Chemical properties
| Hydrogen bond acceptors | 7 |
| Hydrogen bond donors | 0 |
| Rotatable bonds | 4 |
| Molecular weight (Da) | 512.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | Yes |
Database connections
| Structure pdb | 7F83 |
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| ghrelin | GHSR | Human | Ghrelin | A | pKi | 8.85 | 8.85 | 8.85 | Guide to Pharmacology |
| ghrelin | GHSR | Mouse | Ghrelin | A | pKi | 8.11 | 8.11 | 8.11 | Guide to Pharmacology |
| ghrelin | GHSR | Rat | Ghrelin | A | pKi | 8.49 | 8.49 | 8.49 | Guide to Pharmacology |
| ghrelin | GHSR | Human | Ghrelin | A | pKi | 8.18 | 8.18 | 8.18 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| 5-HT2B | 5HT2B | Human | 5-Hydroxytryptamine | A | pIC50 | 5.43 | 5.43 | 5.43 | ChEMBL |