PZM21
| SMILES | C[C@@H](Cc1cscc1)NC(=O)NC[C@@H](N(C)C)Cc1ccc(cc1)O |
| InChIKey | MEDBIJOVZJEMBI-YOEHRIQHSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 3 |
| Rotatable bonds | 8 |
| Molecular weight (Da) | 361.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | Yes |
Database connections
| Structure pdb | 8EFO |
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| μ | OPRM | Human | Opioid | A | pKi | 8.96 | 8.96 | 8.96 | ChEMBL |
| μ | OPRM | Human | Opioid | A | pKi | 8.96 | 8.96 | 8.96 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| μ | OPRM | Human | Opioid | A | pEC50 | 7.24 | 7.84 | 8.6 | ChEMBL |
| μ | OPRM | Human | Opioid | A | pEC50 | 8.34 | 8.34 | 8.34 | Guide to Pharmacology |