ramelteon
SMILES | CCC(=O)NCC[C@@H]1CCc2c1c1CCOc1cc2 |
InChIKey | YLXDSYKOBKBWJQ-LBPRGKRZSA-N |
Chemical properties
Hydrogen bond acceptors | 2 |
Hydrogen bond donors | 1 |
Rotatable bonds | 4 |
Molecular weight (Da) | 259.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
MT1 | MTR1A | Human | Melatonin | A | pKi | 10.9 | 10.9 | 10.9 | Guide to Pharmacology |
MT2 | MTR1B | Human | Melatonin | A | pKi | 10.0 | 10.0 | 10.0 | Guide to Pharmacology |
MT2 | MTR1B | Human | Melatonin | A | pKi | 9.95 | 10.15 | 10.35 | ChEMBL |
MT1 | MTR1A | Human | Melatonin | A | pKi | 10.85 | 10.86 | 10.86 | ChEMBL |
MT2 | MTR1B | Human | Melatonin | A | pKi | 7.98 | 7.98 | 7.98 | Drug Central |
MT1 | MTR1A | Human | Melatonin | A | pKi | 7.96 | 7.96 | 7.96 | Drug Central |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |