RP-52770
SMILES | Clc1cccc(c1)NC(=O)c1ccn2c1CSC2c1cccnc1 |
InChIKey | MJGVBIXLFIUPQU-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 1 |
Rotatable bonds | 3 |
Molecular weight (Da) | 355.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
PAF | PTAFR | Human | Platelet-activating factor | A | pKi | 8.2 | 8.2 | 8.2 | Guide to Pharmacology |
PAF | PTAFR | Human | Platelet-activating factor | A | pKd | 8.4 | 8.4 | 8.4 | Guide to Pharmacology |
PAF | PTAFR | Guinea pig | Platelet-activating factor | A | pKi | 6.56 | 6.56 | 6.56 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |