S26131
| SMILES | CC(=O)NCCc1cccc2c1cc(OCCCOc1ccc3c(c1)c(CCNC(=O)C)ccc3)cc2 |
| InChIKey | NSXBZYDTTKLTOH-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 12 |
| Molecular weight (Da) | 498.3 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| MT1 | MTR1A | Human | Melatonin | A | pKi | 8.4 | 8.85 | 9.3 | Guide to Pharmacology |
| MT2 | MTR1B | Human | Melatonin | A | pKi | 6.8 | 6.9 | 7.0 | Guide to Pharmacology |
| MT2 | MTR1B | Human | Melatonin | A | pKi | 6.45 | 6.83 | 6.95 | ChEMBL |
| MT1 | MTR1A | Human | Melatonin | A | pKi | 6.95 | 8.37 | 9.3 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |