satavaptan
| SMILES | CCOc1ccc2c(c1)[C@@]1(CC[C@H](CC1)OCCN1CCOCC1)C(=O)N2S(=O)(=O)c1ccc(cc1OC)C(=O)NC(C)(C)C |
| InChIKey | QKXJWFOKVQWEDZ-VCCCEUOBSA-N |
Chemical properties
| Hydrogen bond acceptors | 9 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 10 |
| Molecular weight (Da) | 643.3 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | Yes |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 6.5 | 6.5 | 6.5 | Guide to Pharmacology |
| V1B | V1BR | Human | Vasopressin and oxytocin | A | pKi | 4.3 | 4.3 | 4.3 | Guide to Pharmacology |
| V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 8.4 | 8.85 | 9.3 | Guide to Pharmacology |
| V2 | V2R | Rat | Vasopressin and oxytocin | A | pKi | 9.3 | 9.3 | 9.3 | Guide to Pharmacology |
| V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 5.53 | 6.03 | 6.52 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |