SB 612111
| SMILES | O[C@H]1C[C@H](CCc2c1cccc2C)CN1CCC(CC1)c1c(Cl)cccc1Cl |
| InChIKey | OHRDCQFCAWLDBP-SBUREZEXSA-N |
Chemical properties
| Hydrogen bond acceptors | 2 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 3 |
| Molecular weight (Da) | 417.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
| Structure pdb | 5DHH |
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| NOP | OPRX | Human | Opioid | A | pKi | 9.48 | 9.56 | 9.6 | ChEMBL |
| μ | OPRM | Human | Opioid | A | pKi | 7.24 | 7.24 | 7.24 | ChEMBL |
| NOP | OPRX | Human | Opioid | A | pKi | 9.2 | 9.35 | 9.5 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| NOP | OPRX | Human | Opioid | A | pIC50 | 8.2 | 8.95 | 9.7 | Guide to Pharmacology |