SC-41930
| SMILES | CCCc1c(OCCCOc2ccc(c(c2CCC)OC)C(=O)C)ccc2c1OC(CC2)C(=O)O |
| InChIKey | ZVVCSBSDFGYRCB-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 6 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 13 |
| Molecular weight (Da) | 484.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| BLT1 | LT4R1 | Human | Leukotriene | A | pKi | 7.77 | 7.77 | 7.77 | Guide to Pharmacology |
| BLT1 | LT4R1 | Human | Leukotriene | A | pKi | 6.55 | 6.61 | 6.66 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| BLT1 | LT4R1 | Human | Leukotriene | A | pIC50 | 6.1 | 6.1 | 6.1 | Guide to Pharmacology |
| BLT1 | LT4R1 | Human | Leukotriene | A | pIC50 | 6.5 | 7.12 | 9.0 | ChEMBL |