triazine compound PC1
| SMILES | CCc1ccc(cc1)Cn1c(=O)nc(n(c1=O)Cc1ccc(cc1)OC)NCCN=C(N)N |
| InChIKey | FIIIITZGLKCLHY-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 8 |
| Hydrogen bond donors | 3 |
| Rotatable bonds | 10 |
| Molecular weight (Da) | 451.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| PKR1 | PKR1 | Human | Prokineticin | A | pKi | 7.66 | 7.66 | 7.66 | Guide to Pharmacology |
| PKR2 | PKR2 | Human | Prokineticin | A | pKi | 5.79 | 5.79 | 5.79 | Guide to Pharmacology |
| PKR2 | PKR2 | Human | Prokineticin | A | pKi | 5.79 | 5.79 | 5.79 | ChEMBL |
| PKR1 | PKR1 | Human | Prokineticin | A | pKi | 7.66 | 7.66 | 7.66 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |