ambrisentan
| SMILES | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 |
| InChIKey | OUJTZYPIHDYQMC-LJQANCHMSA-N |
Chemical properties
| Hydrogen bond acceptors | 5 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 7 |
| Molecular weight (Da) | 378.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | Yes |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| ETA | EDNRA | Human | Endothelin | A | pKi | 8.02 | 8.02 | 8.02 | Drug Central |
| ETB | EDNRB | Human | Endothelin | A | pKi | 8.16 | 8.16 | 8.16 | Drug Central |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| ETB | EDNRB | Human | Endothelin | A | pIC50 | 5.92 | 5.92 | 5.92 | Guide to Pharmacology |
| ETA | EDNRA | Human | Endothelin | A | pIC50 | 7.66 | 8.33 | 9.0 | ChEMBL |
| ETA | EDNRA | Human | Endothelin | A | pIC50 | 7.66 | 7.66 | 7.66 | Guide to Pharmacology |
| ETA | EDNRA | Human | Endothelin | A | pA2 | 7.1 | 7.1 | 7.1 | Guide to Pharmacology |
| ETB | EDNRB | Human | Endothelin | A | pIC50 | 5.92 | 6.31 | 6.71 | ChEMBL |