vidupiprant
SMILES | OC(=O)Cc1cc(Cl)c(cc1F)Oc1ccc(cc1NS(=O)(=O)c1ccc(cc1Cl)C1CC1)C(=O)NC(C)(C)C |
InChIKey | PFWVGKROPKKEDW-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 5 |
Hydrogen bond donors | 3 |
Rotatable bonds | 9 |
Molecular weight (Da) | 608.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
DP1 | PD2R | Human | Prostanoid | A | pIC50 | 8.4 | 8.4 | 8.4 | Guide to Pharmacology |
DP2 | PD2R2 | Human | Prostanoid | A | pIC50 | 8.52 | 8.52 | 8.52 | Guide to Pharmacology |
DP1 | PD2R | Human | Prostanoid | A | pIC50 | 7.46 | 7.93 | 8.4 | ChEMBL |
DP2 | PD2R2 | Human | Prostanoid | A | pIC50 | 8.1 | 8.31 | 8.52 | ChEMBL |