VU-1545
| SMILES | O=C(c1ccc(cc1)[N+](=O)[O-])Nc1cc(nn1c1ccccc1F)c1ccccc1 |
| InChIKey | BRAZLURTFMCAHU-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 5 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 5 |
| Molecular weight (Da) | 402.1 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 6.81 | 6.81 | 6.81 | Guide to Pharmacology |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 6.8 | 6.8 | 6.8 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pEC50 | 8.0 | 8.0 | 8.0 | Guide to Pharmacology |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pEC50 | 8.02 | 8.02 | 8.02 | ChEMBL |