ATPγS
| SMILES | O[C@@H]1[C@@H](COP(=O)(OP(=O)(OP(=S)([O-])[O-])[O-])[O-])O[C@H]([C@@H]1O)n1cnc2c1ncnc2N |
| InChIKey | NLTUCYMLOPLUHL-KQYNXXCUSA-J |
Chemical properties
| Hydrogen bond acceptors | 18 |
| Hydrogen bond donors | 3 |
| Rotatable bonds | 8 |
| Molecular weight (Da) | 518.9 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| P2Y1 | P2RY1 | Human | P2Y | A | pIC50 | 7.4 | 7.4 | 7.4 | Guide to Pharmacology |
| P2Y11 | P2Y11 | Human | P2Y | A | pEC50 | 4.9 | 5.2 | 5.5 | Guide to Pharmacology |
| P2Y13 | P2Y13 | Human | P2Y | A | pIC50 | 5.5 | 5.5 | 5.5 | Guide to Pharmacology |