balovaptan
| SMILES | CN1Cc2cc(Cl)ccc2n2c(C1)nnc2[C@@H]1CC[C@H](CC1)Oc1ccccn1 |
| InChIKey | GMPZPHGHNDMRKL-RZDIXWSQSA-N |
Chemical properties
| Hydrogen bond acceptors | 6 |
| Hydrogen bond donors | 0 |
| Rotatable bonds | 3 |
| Molecular weight (Da) | 409.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | Yes |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| 5-HT2B | 5HT2B | Human | 5-Hydroxytryptamine | A | pKd | 11.57 | 11.57 | 11.57 | Guide to Pharmacology |
| V1A | V1AR | Human | Vasopressin and oxytocin | A | pKd | 8.59 | 8.59 | 8.59 | Guide to Pharmacology |
| V2 | V2R | Human | Vasopressin and oxytocin | A | pKd | 5.0 | 5.0 | 5.0 | Guide to Pharmacology |
| V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 9.15 | 9.15 | 9.15 | ChEMBL |
| V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 5.92 | 5.92 | 5.92 | ChEMBL |
| OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 5.15 | 5.15 | 5.15 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| V1A | V1AR | Human | Vasopressin and oxytocin | A | pIC50 | 8.52 | 8.52 | 8.52 | ChEMBL |