CHEMBL1765666
SMILES | CC(C)C[C@@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)CCSSC[C@@H](C(=O)N2CCC[C@H]2C(=O)N[C@@H](CCCCNC(=O)CCN)C(=O)NCC(=O)O)NC(=O)[C@H](CC(N)=O)NC1=O |
InChIKey | JMZJCWNFJOHULV-ZTYVOHGWSA-N |
Chemical properties
Hydrogen bond acceptors | 15 |
Hydrogen bond donors | 12 |
Rotatable bonds | 21 |
Molecular weight (Da) | 1097.5 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 5.28 | 5.28 | 5.28 | ChEMBL |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 7.9 | 7.9 | 7.9 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 6.67 | 6.67 | 6.67 | ChEMBL |
V1B | V1BR | Human | Vasopressin and oxytocin | A | pKi | 8.89 | 8.89 | 8.89 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |