CHEMBL2391300
| SMILES | CN[C@@H](CCS(C)(=O)=O)C(=O)N[C@H]1C[C@H]2CC[C@]1(CS(=O)(=O)N1CCN(c3ccccc3C)CC1)C2(C)C |
| InChIKey | CZRITFDAPBAXMY-SMAWTLEESA-N |
Chemical properties
| Hydrogen bond acceptors | 7 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 10 |
| Molecular weight (Da) | 568.3 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| V1B | V1BR | Human | Vasopressin and oxytocin | A | pKi | 5.89 | 5.89 | 5.89 | ChEMBL |
| V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 6.74 | 6.74 | 6.74 | ChEMBL |
| OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 8.28 | 8.28 | 8.28 | ChEMBL |
| V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 6.21 | 6.21 | 6.21 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| V1A | V1AR | Rat | Vasopressin and oxytocin | A | pIC50 | 6.5 | 6.5 | 6.5 | ChEMBL |
| V2 | V2R | Rat | Vasopressin and oxytocin | A | pIC50 | 6.46 | 6.46 | 6.46 | ChEMBL |
| OT | OXYR | Rat | Vasopressin and oxytocin | A | pIC50 | 8.04 | 8.04 | 8.04 | ChEMBL |