CHEMBL24526
| SMILES | CC(=O)N1CCC(Oc2ccc(CC(=O)N3CCC(N4C(=O)OCc5ccccc54)CC3)c(OCC(F)(F)F)c2)CC1 |
| InChIKey | VGSQHYIAUDIJTE-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 6 |
| Hydrogen bond donors | 0 |
| Rotatable bonds | 7 |
| Molecular weight (Da) | 589.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| V1A | V1AR | Rat | Vasopressin and oxytocin | A | pKi | 8.7 | 8.7 | 8.7 | ChEMBL |
| V2 | V2R | Rat | Vasopressin and oxytocin | A | pKi | 6.82 | 6.82 | 6.82 | ChEMBL |
| OT | OXYR | Rat | Vasopressin and oxytocin | A | pKi | 9.15 | 9.15 | 9.15 | ChEMBL |
| V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 6.89 | 6.89 | 6.89 | ChEMBL |
| OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 8.85 | 8.85 | 8.85 | ChEMBL |
| V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 6.13 | 6.13 | 6.13 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |