clazosentan
| SMILES | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC |
| InChIKey | LFWCJABOXHSRGC-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 13 |
| Hydrogen bond donors | 3 |
| Rotatable bonds | 11 |
| Molecular weight (Da) | 577.1 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | Yes |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| ETB | EDNRB | Human | Endothelin | A | pKi | 6.76 | 6.76 | 6.76 | Guide to Pharmacology |
| ETB | EDNRB | Human | Endothelin | A | pKi | 6.76 | 6.76 | 6.76 | ChEMBL |
| ETA | EDNRA | Human | Endothelin | A | pKi | 9.89 | 9.89 | 9.89 | ChEMBL |
| ETA | EDNRA | Human | Endothelin | A | pKi | 9.89 | 9.89 | 9.89 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| ETB | EDNRB | Human | Endothelin | A | pIC50 | 6.76 | 6.76 | 6.76 | ChEMBL |
| ETA | EDNRA | Human | Endothelin | A | pIC50 | 8.77 | 8.77 | 8.77 | ChEMBL |
| ETA | EDNRA | Human | Endothelin | A | pA2 | 9.5 | 9.5 | 9.5 | Guide to Pharmacology |