Ligand source activities (1 row/activity)
| Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Potency) |
# tested GPCRs (Potency) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
| 11344 | 762 | 0 | None | - | 1 | Human | 6.2 | pEC50 | = | 6.2 | Functional | Guide to Pharmacology | None | None | None | None | 31036565 | ||||
| 574 | 760 | 0 | None | 69 | 2 | Human | 8.6 | pEC50 | = | 8.6 | Functional | Guide to Pharmacology | None | None | None | None | None | ||||
| 573 | 757 | 0 | None | -1 | 2 | Human | 8.9 | pEC50 | = | 8.9 | Functional | Guide to Pharmacology | None | None | None | None | 11773063 | ||||
| 5768 | 761 | 0 | None | - | 1 | Human | 4.7 | pIC50 | = | 4.7 | Functional | Guide to Pharmacology | None | None | None | None | 12899627 | ||||
| 5770 | 899 | 0 | None | - | 1 | Human | 6.6 | pIC50 | = | 6.6 | Functional | Guide to Pharmacology | None | None | None | None | 17258808 | ||||
| 574 | 760 | 0 | None | 69 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | Guide to Pharmacology | None | None | None | None | 11773063 | ||||
| 574 | 760 | 0 | None | 69 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | Guide to Pharmacology | None | None | None | None | 12899627 | ||||
| 573 | 757 | 0 | None | -1 | 2 | Human | 8.3 | pIC50 | = | 8.3 | Functional | Guide to Pharmacology | None | None | None | None | 11773063 | ||||
| 573 | 757 | 0 | None | -1 | 2 | Human | 8.3 | pIC50 | = | 8.3 | Functional | Guide to Pharmacology | None | None | None | None | 12899627 | ||||
| 5780 | 211 | 0 | None | -37 | 2 | Mouse | 6.0 | pIC50 | ~ | 6 | Functional | Guide to Pharmacology | None | None | None | None | 14570896 | ||||
| Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Affinity) |
# tested GPCRs (Affinity) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
| 155541442 | 172441 | 0 | None | - | 0 | Human | 5.2 | pEC50 | = | 5.2 | Binding | ChEMBL | 1119 | 29 | 17 | 13 | -0.9 | CC(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O | nan | ||
| CHEMBL4518532 | 172441 | 0 | None | - | 0 | Human | 5.2 | pEC50 | = | 5.2 | Binding | ChEMBL | 1119 | 29 | 17 | 13 | -0.9 | CC(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O | nan | ||
| 155555017 | 173729 | 0 | None | - | 1 | Human | 5.1 | pEC50 | = | 5.1 | Binding | ChEMBL | 898 | 28 | 14 | 9 | 0.4 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(C)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O | nan | ||
| CHEMBL4550325 | 173729 | 0 | None | - | 1 | Human | 5.1 | pEC50 | = | 5.1 | Binding | ChEMBL | 898 | 28 | 14 | 9 | 0.4 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(C)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O | nan | ||
| 155555017 | 173729 | 0 | None | - | 1 | Human | 4.3 | pKi | = | 4.3 | Binding | ChEMBL | 898 | 28 | 14 | 9 | 0.4 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(C)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O | nan | ||
| CHEMBL4550325 | 173729 | 0 | None | - | 1 | Human | 4.3 | pKi | = | 4.3 | Binding | ChEMBL | 898 | 28 | 14 | 9 | 0.4 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(C)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O | nan | ||
| 9384 | 2926 | 0 | None | - | 1 | Human | 3.7 | pKi | = | 3.7 | Binding | Guide to Pharmacology | None | None | None | None | 27108698 | ||||
| 9385 | 2928 | 0 | None | - | 1 | Human | 4.2 | pKi | = | 4.2 | Binding | Guide to Pharmacology | None | None | None | None | 27108698 | ||||