Ligand source activities (1 row/activity)
Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Potency) |
# tested GPCRs (Potency) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Affinity) |
# tested GPCRs (Affinity) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
10327 | 3390 | 60 | None | - | 1 | Human | 5.6 | pKd | = | 5.6 | Binding | Guide to Pharmacology | 489 | 6 | 1 | 4 | 6.8 | CNC1CCC(CC1)N(C(=O)c1sc2c(c1Cl)cccc2)Cc1cccc(c1)c1ccncc1 | 31964872 | ||
5284330 | 3390 | 60 | None | - | 1 | Human | 5.6 | pKd | = | 5.6 | Binding | Guide to Pharmacology | 489 | 6 | 1 | 4 | 6.8 | CNC1CCC(CC1)N(C(=O)c1sc2c(c1Cl)cccc2)Cc1cccc(c1)c1ccncc1 | 31964872 | ||
CHEMBL1221983 | 3390 | 60 | None | - | 1 | Human | 5.6 | pKd | = | 5.6 | Binding | Guide to Pharmacology | 489 | 6 | 1 | 4 | 6.8 | CNC1CCC(CC1)N(C(=O)c1sc2c(c1Cl)cccc2)Cc1cccc(c1)c1ccncc1 | 31964872 |