Ligand source activities (1 row/activity)
Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Potency) |
# tested GPCRs (Potency) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
10197 | 3897 | 0 | None | -14 | 5 | Human | 8.0 | pIC50 | ~ | 8 | Functional | Guide to Pharmacology | None | None | None | None | 22753465 |
Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Affinity) |
# tested GPCRs (Affinity) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
2554 | 782 | 115 | None | -81 | 8 | Mouse | 4.8 | pKd | = | 4.8 | Binding | ChEMBL | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 10.1021/acs.jmedchem.9b02020 | ||
489 | 782 | 115 | None | -81 | 8 | Mouse | 4.8 | pKd | = | 4.8 | Binding | ChEMBL | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 10.1021/acs.jmedchem.9b02020 | ||
5339 | 782 | 115 | None | -81 | 8 | Mouse | 4.8 | pKd | = | 4.8 | Binding | ChEMBL | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 10.1021/acs.jmedchem.9b02020 | ||
CHEMBL108 | 782 | 115 | None | -81 | 8 | Mouse | 4.8 | pKd | = | 4.8 | Binding | ChEMBL | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 10.1021/acs.jmedchem.9b02020 | ||
DB00564 | 782 | 115 | None | -81 | 8 | Mouse | 4.8 | pKd | = | 4.8 | Binding | ChEMBL | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 10.1021/acs.jmedchem.9b02020 | ||
2554 | 782 | 115 | None | -1 | 8 | Human | 8.3 | pKd | = | 8.3 | Binding | Drug Central | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | None | ||
489 | 782 | 115 | None | -1 | 8 | Human | 8.3 | pKd | = | 8.3 | Binding | Drug Central | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | None | ||
5339 | 782 | 115 | None | -1 | 8 | Human | 8.3 | pKd | = | 8.3 | Binding | Drug Central | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | None | ||
CHEMBL108 | 782 | 115 | None | -1 | 8 | Human | 8.3 | pKd | = | 8.3 | Binding | Drug Central | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | None | ||
DB00564 | 782 | 115 | None | -1 | 8 | Human | 8.3 | pKd | = | 8.3 | Binding | Drug Central | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | None | ||
2554 | 782 | 115 | None | -1 | 8 | Human | 4.8 | pKd | = | 4.8 | Binding | Guide to Pharmacology | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 32049522 | ||
489 | 782 | 115 | None | -1 | 8 | Human | 4.8 | pKd | = | 4.8 | Binding | Guide to Pharmacology | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 32049522 | ||
5339 | 782 | 115 | None | -1 | 8 | Human | 4.8 | pKd | = | 4.8 | Binding | Guide to Pharmacology | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 32049522 | ||
CHEMBL108 | 782 | 115 | None | -1 | 8 | Human | 4.8 | pKd | = | 4.8 | Binding | Guide to Pharmacology | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 32049522 | ||
DB00564 | 782 | 115 | None | -1 | 8 | Human | 4.8 | pKd | = | 4.8 | Binding | Guide to Pharmacology | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 32049522 |